C18H17BrNO5PS — CID 59533955
[(3-bromo-5-methylphenyl)sulfonyl-naphthalen-1-ylamino]methylphosphonic acid (PubChem CID 59533955) has the molecular formula C18H17BrNO5PS and a molecular weight of 470.28 g/mol. Its IUPAC name is [(3-bromo-5-methylphenyl)sulfonyl-naphthalen-1-ylamino]methylphosphonic acid.
| Compound Name | [(3-bromo-5-methylphenyl)sulfonyl-naphthalen-1-ylamino]methylphosphonic acid |
|---|---|
| PubChem CID | 59533955 |
| Molecular Formula | C18H17BrNO5PS |
| Molecular Weight | 470.28 g/mol |
| Exact Mass | 468.97 |
| IUPAC Name | [(3-bromo-5-methylphenyl)sulfonyl-naphthalen-1-ylamino]methylphosphonic acid |
| SMILES | Cc1cc(Br)cc(S(=O)(=O)N(CP(=O)(O)O)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C18H17BrNO5PS/c1-13-9-15(19)11-16(10-13)27(24,25)20(12-26(21,22)23)18-8-4-6-14-5-2-3-7-17(14)18/h2-11H,12H2,1H3,(H2,21,22,23) |
| InChIKey | VKUAXWFNKKUZCQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.28 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|