C17H22N2O — CID 60570383
N,N-diethyl-2-[methyl(naphthalen-1-yl)amino]acetamide (PubChem CID 60570383) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is N,N-diethyl-2-[methyl(naphthalen-1-yl)amino]acetamide.
| Compound Name | N,N-diethyl-2-[methyl(naphthalen-1-yl)amino]acetamide |
|---|---|
| PubChem CID | 60570383 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | N,N-diethyl-2-[methyl(naphthalen-1-yl)amino]acetamide |
| SMILES | CCN(CC)C(=O)CN(C)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H22N2O/c1-4-19(5-2)17(20)13-18(3)16-12-8-10-14-9-6-7-11-15(14)16/h6-12H,4-5,13H2,1-3H3 |
| InChIKey | HDUKNVAQIUBHLC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |