C21H22ClN — CID 141457473
N-methyl-N-[(E)-3-(4-methylphenyl)prop-2-enyl]naphthalen-1-amine;hydrochloride (PubChem CID 141457473) has the molecular formula C21H22ClN and a molecular weight of 323.87 g/mol. Its IUPAC name is N-methyl-N-[(E)-3-(4-methylphenyl)prop-2-enyl]naphthalen-1-amine;hydrochloride.
| Compound Name | N-methyl-N-[(E)-3-(4-methylphenyl)prop-2-enyl]naphthalen-1-amine;hydrochloride |
|---|---|
| PubChem CID | 141457473 |
| Molecular Formula | C21H22ClN |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-methyl-N-[(E)-3-(4-methylphenyl)prop-2-enyl]naphthalen-1-amine;hydrochloride |
| SMILES | Cc1ccc(/C=C/CN(C)c2cccc3ccccc23)cc1.Cl |
| InChI | InChI=1S/C21H21N.ClH/c1-17-12-14-18(15-13-17)7-6-16-22(2)21-11-5-9-19-8-3-4-10-20(19)21;/h3-15H,16H2,1-2H3;1H/b7-6+; |
| InChIKey | AQLZBNXZHFCKBZ-UHDJGPCESA-N |
| XLogP | 5.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |