C10H17NO2 — CID 155691987
(3E,5Z)-2,3-dimethyl-4-nitroocta-3,5-diene (PubChem CID 155691987) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (3E,5Z)-2,3-dimethyl-4-nitroocta-3,5-diene.
| Compound Name | (3E,5Z)-2,3-dimethyl-4-nitroocta-3,5-diene |
|---|---|
| PubChem CID | 155691987 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (3E,5Z)-2,3-dimethyl-4-nitroocta-3,5-diene |
| SMILES | CC/C=C\C(=C(\C)C(C)C)[N+](=O)[O-] |
| InChI | InChI=1S/C10H17NO2/c1-5-6-7-10(11(12)13)9(4)8(2)3/h6-8H,5H2,1-4H3/b7-6-,10-9+ |
| InChIKey | WSQJZNFGJNVZNP-IXWMQOLASA-N |
| XLogP | 3.16 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|