C16H22N4O3 — CID 142976078
2-[(E)-C-methyl-N-[methyl-[(1Z,3Z)-1-(methylamino)-2-nitrohexa-1,3-dienyl]amino]carbonimidoyl]phenol (PubChem CID 142976078) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is 2-[(E)-C-methyl-N-[methyl-[(1Z,3Z)-1-(methylamino)-2-nitrohexa-1,3-dienyl]amino]carbonimidoyl]phenol.
| Compound Name | 2-[(E)-C-methyl-N-[methyl-[(1Z,3Z)-1-(methylamino)-2-nitrohexa-1,3-dienyl]amino]carbonimidoyl]phenol |
|---|---|
| PubChem CID | 142976078 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 2-[(E)-C-methyl-N-[methyl-[(1Z,3Z)-1-(methylamino)-2-nitrohexa-1,3-dienyl]amino]carbonimidoyl]phenol |
| SMILES | CC/C=C\C(=C(/NC)N(C)/N=C(\C)c1ccccc1O)[N+](=O)[O-] |
| InChI | InChI=1S/C16H22N4O3/c1-5-6-10-14(20(22)23)16(17-3)19(4)18-12(2)13-9-7-8-11-15(13)21/h6-11,17,21H,5H2,1-4H3/b10-6-,16-14-,18-12+ |
| InChIKey | JZXDCRUBWFKGOX-TZLDCXPPSA-N |
| XLogP | 2.68 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|