C9H10N2O2 — CID 135450929
N-[(E)-1-(2-hydroxyphenyl)ethylideneamino]formamide (PubChem CID 135450929) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is N-[(E)-1-(2-hydroxyphenyl)ethylideneamino]formamide.
| Compound Name | N-[(E)-1-(2-hydroxyphenyl)ethylideneamino]formamide |
|---|---|
| PubChem CID | 135450929 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | N-[(E)-1-(2-hydroxyphenyl)ethylideneamino]formamide |
| SMILES | C/C(=N\NC=O)c1ccccc1O |
| InChI | InChI=1S/C9H10N2O2/c1-7(11-10-6-12)8-4-2-3-5-9(8)13/h2-6,13H,1H3,(H,10,12)/b11-7+ |
| InChIKey | OYJLIPBFUXIYQM-YRNVUSSQSA-N |
| XLogP | 0.86 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|