C22H26N4O4S — CID 136759335
(2S)-N-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]-2-[(2S)-1-[(2Z)-2-[1-(2-hydroxyphenyl)ethylidene]hydrazinyl]-1-oxopropan-2-yl]sulfanylpropanamide (PubChem CID 136759335) has the molecular formula C22H26N4O4S and a molecular weight of 442.54 g/mol. Its IUPAC name is (2S)-N-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]-2-[(2S)-1-[(2Z)-2-[1-(2-hydroxyphenyl)ethylidene]hydrazinyl]-1-oxopropan-2-yl]sulfanylpropanamide.
| Compound Name | (2S)-N-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]-2-[(2S)-1-[(2Z)-2-[1-(2-hydroxyphenyl)ethylidene]hydrazinyl]-1-oxopropan-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 136759335 |
| Molecular Formula | C22H26N4O4S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | (2S)-N-[(Z)-1-(2-hydroxyphenyl)ethylideneamino]-2-[(2S)-1-[(2Z)-2-[1-(2-hydroxyphenyl)ethylidene]hydrazinyl]-1-oxopropan-2-yl]sulfanylpropanamide |
| SMILES | C/C(=N/NC(=O)[C@H](C)S[C@@H](C)C(=O)N/N=C(/C)c1ccccc1O)c1ccccc1O |
| InChI | InChI=1S/C22H26N4O4S/c1-13(17-9-5-7-11-19(17)27)23-25-21(29)15(3)31-16(4)22(30)26-24-14(2)18-10-6-8-12-20(18)28/h5-12,15-16,27-28H,1-4H3,(H,25,29)(H,26,30)/b23-13-,24-14-/t15-,16-/m0/s1 |
| InChIKey | LCPLTURMCNZSNV-JBHTYQCFSA-N |
| XLogP | 2.99 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|