C11H14N2O — CID 166829852
N-[(Z)-1-(2,4-dimethylphenyl)ethylideneamino]formamide (PubChem CID 166829852) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is N-[(Z)-1-(2,4-dimethylphenyl)ethylideneamino]formamide.
| Compound Name | N-[(Z)-1-(2,4-dimethylphenyl)ethylideneamino]formamide |
|---|---|
| PubChem CID | 166829852 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | N-[(Z)-1-(2,4-dimethylphenyl)ethylideneamino]formamide |
| SMILES | C/C(=N/NC=O)c1ccc(C)cc1C |
| InChI | InChI=1S/C11H14N2O/c1-8-4-5-11(9(2)6-8)10(3)13-12-7-14/h4-7H,1-3H3,(H,12,14)/b13-10- |
| InChIKey | NSVLITFOJONEPG-RAXLEYEMSA-N |
| XLogP | 1.77 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|