C19H22N2O3 — CID 3627864
N-[1-(2,4-dimethylphenyl)ethylideneamino]-3,4-dimethoxybenzamide (PubChem CID 3627864) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-[1-(2,4-dimethylphenyl)ethylideneamino]-3,4-dimethoxybenzamide.
| Compound Name | N-[1-(2,4-dimethylphenyl)ethylideneamino]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 3627864 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N-[1-(2,4-dimethylphenyl)ethylideneamino]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)NN=C(C)c2ccc(C)cc2C)cc1OC |
| InChI | InChI=1S/C19H22N2O3/c1-12-6-8-16(13(2)10-12)14(3)20-21-19(22)15-7-9-17(23-4)18(11-15)24-5/h6-11H,1-5H3,(H,21,22) |
| InChIKey | LAOQPBHDHOQWCE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|