C17H16Cl2N2O3 — CID 55353185
N-[(E)-1-(2,5-dichlorophenyl)ethylideneamino]-3,4-dimethoxybenzamide (PubChem CID 55353185) has the molecular formula C17H16Cl2N2O3 and a molecular weight of 367.23 g/mol. Its IUPAC name is N-[(E)-1-(2,5-dichlorophenyl)ethylideneamino]-3,4-dimethoxybenzamide.
| Compound Name | N-[(E)-1-(2,5-dichlorophenyl)ethylideneamino]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 55353185 |
| Molecular Formula | C17H16Cl2N2O3 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | N-[(E)-1-(2,5-dichlorophenyl)ethylideneamino]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C(\C)c2cc(Cl)ccc2Cl)cc1OC |
| InChI | InChI=1S/C17H16Cl2N2O3/c1-10(13-9-12(18)5-6-14(13)19)20-21-17(22)11-4-7-15(23-2)16(8-11)24-3/h4-9H,1-3H3,(H,21,22)/b20-10+ |
| InChIKey | QHCFCHDEOSOOJP-KEBDBYFISA-N |
| XLogP | 4.16 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|