About (2E,6Z)-1-[2-(dimethylamino)phenyl]nona-2,6-dien-1-one
(2E,6Z)-1-[2-(dimethylamino)phenyl]nona-2,6-dien-1-one (PubChem CID 71536567) has the molecular formula C17H23NO
and a molecular weight of 257.38 g/mol. Its IUPAC name is (2E,6Z)-1-[2-(dimethylamino)phenyl]nona-2,6-dien-1-one.
Molecular Properties
| Compound Name | (2E,6Z)-1-[2-(dimethylamino)phenyl]nona-2,6-dien-1-one |
| PubChem CID | 71536567 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (2E,6Z)-1-[2-(dimethylamino)phenyl]nona-2,6-dien-1-one |
| SMILES | CC/C=C\CC/C=C/C(=O)c1ccccc1N(C)C |
| InChI | InChI=1S/C17H23NO/c1-4-5-6-7-8-9-14-17(19)15-12-10-11-13-16(15)18(2)3/h5-6,9-14H,4,7-8H2,1-3H3/b6-5-,14-9+ |
| InChIKey | KKIZCNUMUYIGPD-HMLIUESASA-N |
| XLogP | 4.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E,6Z)-1-[2-(dimethylamino)phenyl]nona-2,6-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,6Z)-1-[2-(dimethylamino)phenyl]nona-2,6-dien-1-one?
The IUPAC name of (2E,6Z)-1-[2-(dimethylamino)phenyl]nona-2,6-dien-1-one (CID 71536567) is (2E,6Z)-1-[2-(dimethylamino)phenyl]nona-2,6-dien-1-one.
What is the SMILES notation for (2E,6Z)-1-[2-(dimethylamino)phenyl]nona-2,6-dien-1-one?
The canonical SMILES for (2E,6Z)-1-[2-(dimethylamino)phenyl]nona-2,6-dien-1-one is CC/C=C\CC/C=C/C(=O)c1ccccc1N(C)C.
What is the InChIKey of (2E,6Z)-1-[2-(dimethylamino)phenyl]nona-2,6-dien-1-one?
The InChIKey is KKIZCNUMUYIGPD-HMLIUESASA-N. The full InChI is InChI=1S/C17H23NO/c1-4-5-6-7-8-9-14-17(19)15-12-10-11-13-16(15)18(2)3/h5-6,9-14H,4,7-8H2,1-3H3/b6-5-,14-9+.
What are the key properties of (2E,6Z)-1-[2-(dimethylamino)phenyl]nona-2,6-dien-1-one?
(2E,6Z)-1-[2-(dimethylamino)phenyl]nona-2,6-dien-1-one has a molecular weight of 257.38 g/mol, XLogP of 4.24, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,6Z)-1-[2-(dimethylamino)phenyl]nona-2,6-dien-1-one is sourced from PubChem (CID 71536567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).