C17H23NO — CID 71536567
(2E,6Z)-1-[2-(dimethylamino)phenyl]nona-2,6-dien-1-one (PubChem CID 71536567) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is (2E,6Z)-1-[2-(dimethylamino)phenyl]nona-2,6-dien-1-one.
| Compound Name | (2E,6Z)-1-[2-(dimethylamino)phenyl]nona-2,6-dien-1-one |
|---|---|
| PubChem CID | 71536567 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (2E,6Z)-1-[2-(dimethylamino)phenyl]nona-2,6-dien-1-one |
| SMILES | CC/C=C\CC/C=C/C(=O)c1ccccc1N(C)C |
| InChI | InChI=1S/C17H23NO/c1-4-5-6-7-8-9-14-17(19)15-12-10-11-13-16(15)18(2)3/h5-6,9-14H,4,7-8H2,1-3H3/b6-5-,14-9+ |
| InChIKey | KKIZCNUMUYIGPD-HMLIUESASA-N |
| XLogP | 4.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|