C19H22N2O — CID 175290559
1-[2,3-bis(dimethylamino)phenyl]-3-phenylprop-2-en-1-one (PubChem CID 175290559) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-[2,3-bis(dimethylamino)phenyl]-3-phenylprop-2-en-1-one.
| Compound Name | 1-[2,3-bis(dimethylamino)phenyl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 175290559 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 1-[2,3-bis(dimethylamino)phenyl]-3-phenylprop-2-en-1-one |
| SMILES | CN(C)c1cccc(C(=O)C=Cc2ccccc2)c1N(C)C |
| InChI | InChI=1S/C19H22N2O/c1-20(2)17-12-8-11-16(19(17)21(3)4)18(22)14-13-15-9-6-5-7-10-15/h5-14H,1-4H3 |
| InChIKey | JDYGMNBJMBRTFA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|