C21H14O5 — CID 11359948
4-[(E)-3-phenylprop-2-enoyl]naphthalene-1,8-dicarboxylic acid (PubChem CID 11359948) has the molecular formula C21H14O5 and a molecular weight of 346.34 g/mol. Its IUPAC name is 4-[(E)-3-phenylprop-2-enoyl]naphthalene-1,8-dicarboxylic acid.
| Compound Name | 4-[(E)-3-phenylprop-2-enoyl]naphthalene-1,8-dicarboxylic acid |
|---|---|
| PubChem CID | 11359948 |
| Molecular Formula | C21H14O5 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 4-[(E)-3-phenylprop-2-enoyl]naphthalene-1,8-dicarboxylic acid |
| SMILES | O=C(/C=C/c1ccccc1)c1ccc(C(=O)O)c2c(C(=O)O)cccc12 |
| InChI | InChI=1S/C21H14O5/c22-18(12-9-13-5-2-1-3-6-13)14-10-11-17(21(25)26)19-15(14)7-4-8-16(19)20(23)24/h1-12H,(H,23,24)(H,25,26)/b12-9+ |
| InChIKey | UKAIYFXGXNKQPY-FMIVXFBMSA-N |
| XLogP | 4.13 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|