C10H17NO2 — CID 143537704
ethane;(2Z,4E,6Z)-4-nitroocta-2,4,6-triene (PubChem CID 143537704) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is ethane;(2Z,4E,6Z)-4-nitroocta-2,4,6-triene.
| Compound Name | ethane;(2Z,4E,6Z)-4-nitroocta-2,4,6-triene |
|---|---|
| PubChem CID | 143537704 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | ethane;(2Z,4E,6Z)-4-nitroocta-2,4,6-triene |
| SMILES | C/C=C\C=C(/C=C\C)[N+](=O)[O-].CC |
| InChI | InChI=1S/C8H11NO2.C2H6/c1-3-5-7-8(6-4-2)9(10)11;1-2/h3-7H,1-2H3;1-2H3/b5-3-,6-4-,8-7+; |
| InChIKey | PSWUWGJPVVMMLG-IYJPSQMASA-N |
| XLogP | 3.33 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|