About ethane;(4Z)-2-methylhexa-2,4-diene;nitromethane
ethane;(4Z)-2-methylhexa-2,4-diene;nitromethane (PubChem CID 142945468) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is ethane;(4Z)-2-methylhexa-2,4-diene;nitromethane.
Molecular Properties
| Compound Name | ethane;(4Z)-2-methylhexa-2,4-diene;nitromethane |
| PubChem CID | 142945468 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | ethane;(4Z)-2-methylhexa-2,4-diene;nitromethane |
| SMILES | C/C=C\C=C(C)C.CC.C[N+](=O)[O-] |
| InChI | InChI=1S/C7H12.C2H6.CH3NO2/c1-4-5-6-7(2)3;1-2;1-2(3)4/h4-6H,1-3H3;1-2H3;1H3/b5-4-;; |
| InChIKey | JWQNLTLJIQBRKK-WNCVTPEDSA-N |
| XLogP | 3.45 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(4Z)-2-methylhexa-2,4-diene;nitromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4Z)-2-methylhexa-2,4-diene;nitromethane?
The IUPAC name of ethane;(4Z)-2-methylhexa-2,4-diene;nitromethane (CID 142945468) is ethane;(4Z)-2-methylhexa-2,4-diene;nitromethane.
What is the SMILES notation for ethane;(4Z)-2-methylhexa-2,4-diene;nitromethane?
The canonical SMILES for ethane;(4Z)-2-methylhexa-2,4-diene;nitromethane is C/C=C\C=C(C)C.CC.C[N+](=O)[O-].
What is the InChIKey of ethane;(4Z)-2-methylhexa-2,4-diene;nitromethane?
The InChIKey is JWQNLTLJIQBRKK-WNCVTPEDSA-N. The full InChI is InChI=1S/C7H12.C2H6.CH3NO2/c1-4-5-6-7(2)3;1-2;1-2(3)4/h4-6H,1-3H3;1-2H3;1H3/b5-4-;;.
What are the key properties of ethane;(4Z)-2-methylhexa-2,4-diene;nitromethane?
ethane;(4Z)-2-methylhexa-2,4-diene;nitromethane has a molecular weight of 187.28 g/mol, XLogP of 3.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4Z)-2-methylhexa-2,4-diene;nitromethane is sourced from PubChem (CID 142945468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).