C12H14CdO4 — CID 159713747
cadmium(2+);bis(hexa-2,4-dienoate) (PubChem CID 159713747) has the molecular formula C12H14CdO4 and a molecular weight of 334.65 g/mol. Its IUPAC name is cadmium(2+);bis(hexa-2,4-dienoate).
| Compound Name | cadmium(2+);bis(hexa-2,4-dienoate) |
|---|---|
| PubChem CID | 159713747 |
| Molecular Formula | C12H14CdO4 |
| Molecular Weight | 334.65 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | cadmium(2+);bis(hexa-2,4-dienoate) |
| SMILES | CC=CC=CC(=O)[O-].CC=CC=CC(=O)[O-].[Cd+2] |
| InChI | InChI=1S/2C6H8O2.Cd/c2*1-2-3-4-5-6(7)8;/h2*2-5H,1H3,(H,7,8);/q;;+2/p-2 |
| InChIKey | MZDYTAREBXNADB-UHFFFAOYSA-L |
| XLogP | -0.27 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.65 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|