About cadmium(2+);bis(hexa-2,4-dienoate)
cadmium(2+);bis(hexa-2,4-dienoate) (PubChem CID 159713747) has the molecular formula C12H14CdO4
and a molecular weight of 334.65 g/mol. Its IUPAC name is cadmium(2+);bis(hexa-2,4-dienoate).
Molecular Properties
| Compound Name | cadmium(2+);bis(hexa-2,4-dienoate) |
| PubChem CID | 159713747 |
| Molecular Formula | C12H14CdO4 |
| Molecular Weight | 334.65 g/mol |
| Exact Mass | 335.99 |
| IUPAC Name | cadmium(2+);bis(hexa-2,4-dienoate) |
| SMILES | CC=CC=CC(=O)[O-].CC=CC=CC(=O)[O-].[Cd+2] |
| InChI | InChI=1S/2C6H8O2.Cd/c2*1-2-3-4-5-6(7)8;/h2*2-5H,1H3,(H,7,8);/q;;+2/p-2 |
| InChIKey | MZDYTAREBXNADB-UHFFFAOYSA-L |
| XLogP | -0.27 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.65 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze cadmium(2+);bis(hexa-2,4-dienoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium(2+);bis(hexa-2,4-dienoate)?
The IUPAC name of cadmium(2+);bis(hexa-2,4-dienoate) (CID 159713747) is cadmium(2+);bis(hexa-2,4-dienoate).
What is the SMILES notation for cadmium(2+);bis(hexa-2,4-dienoate)?
The canonical SMILES for cadmium(2+);bis(hexa-2,4-dienoate) is CC=CC=CC(=O)[O-].CC=CC=CC(=O)[O-].[Cd+2].
What is the InChIKey of cadmium(2+);bis(hexa-2,4-dienoate)?
The InChIKey is MZDYTAREBXNADB-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H8O2.Cd/c2*1-2-3-4-5-6(7)8;/h2*2-5H,1H3,(H,7,8);/q;;+2/p-2.
What are the key properties of cadmium(2+);bis(hexa-2,4-dienoate)?
cadmium(2+);bis(hexa-2,4-dienoate) has a molecular weight of 334.65 g/mol, XLogP of -0.27, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium(2+);bis(hexa-2,4-dienoate) is sourced from PubChem (CID 159713747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).