C12H13KO2 — CID 174738022
potassium;benzene;(2E,4E)-hexa-2,4-dienoate (PubChem CID 174738022) has the molecular formula C12H13KO2 and a molecular weight of 228.33 g/mol. Its IUPAC name is potassium;benzene;(2E,4E)-hexa-2,4-dienoate.
| Compound Name | potassium;benzene;(2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 174738022 |
| Molecular Formula | C12H13KO2 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | potassium;benzene;(2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)[O-].[K+].c1ccccc1 |
| InChI | InChI=1S/C6H8O2.C6H6.K/c1-2-3-4-5-6(7)8;1-2-4-6-5-3-1;/h2-5H,1H3,(H,7,8);1-6H;/q;;+1/p-1/b3-2+,5-4+;; |
| InChIKey | LUKMUXODFXEALH-IOUXFWSCSA-M |
| XLogP | -1.44 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|