potassium;hexa-2,4-dienoate;propanoic acid

C9H13KO4 — CID 161130297

IUPACpotassium;hexa-2,4-dienoate;propanoic acid
SMILESCC=CC=CC(=O)[O-].CCC(=O)O.[K+]
InChIInChI=1S/C6H8O2.C3H6O2.K/c1-2-3-4-5-6(7)8;1-2-3(4)5;/h2-5H,1H3,(H,7,8);2H2,1H3,(H,4,5);/q;;+1/p-1
InChIKeyUMBYUNWPHRAFBW-UHFFFAOYSA-M
MW224.30 g/mol
LogP-2.65
Rot. Bonds3

About potassium;hexa-2,4-dienoate;propanoic acid

potassium;hexa-2,4-dienoate;propanoic acid (PubChem CID 161130297) has the molecular formula C9H13KO4 and a molecular weight of 224.30 g/mol. Its IUPAC name is potassium;hexa-2,4-dienoate;propanoic acid.

Molecular Properties

Compound Namepotassium;hexa-2,4-dienoate;propanoic acid
PubChem CID161130297
Molecular FormulaC9H13KO4
Molecular Weight224.30 g/mol
Exact Mass224.05
IUPAC Namepotassium;hexa-2,4-dienoate;propanoic acid
SMILESCC=CC=CC(=O)[O-].CCC(=O)O.[K+]
InChIInChI=1S/C6H8O2.C3H6O2.K/c1-2-3-4-5-6(7)8;1-2-3(4)5;/h2-5H,1H3,(H,7,8);2H2,1H3,(H,4,5);/q;;+1/p-1
InChIKeyUMBYUNWPHRAFBW-UHFFFAOYSA-M
XLogP-2.65
TPSA77.43 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.30
LogP ≤ 5-2.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze potassium;hexa-2,4-dienoate;propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium;hexa-2,4-dienoate;propanoic acid?
The IUPAC name of potassium;hexa-2,4-dienoate;propanoic acid (CID 161130297) is potassium;hexa-2,4-dienoate;propanoic acid.
What is the SMILES notation for potassium;hexa-2,4-dienoate;propanoic acid?
The canonical SMILES for potassium;hexa-2,4-dienoate;propanoic acid is CC=CC=CC(=O)[O-].CCC(=O)O.[K+].
What is the InChIKey of potassium;hexa-2,4-dienoate;propanoic acid?
The InChIKey is UMBYUNWPHRAFBW-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H8O2.C3H6O2.K/c1-2-3-4-5-6(7)8;1-2-3(4)5;/h2-5H,1H3,(H,7,8);2H2,1H3,(H,4,5);/q;;+1/p-1.
What are the key properties of potassium;hexa-2,4-dienoate;propanoic acid?
potassium;hexa-2,4-dienoate;propanoic acid has a molecular weight of 224.30 g/mol, XLogP of -2.65, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hexa-2,4-dienoate;propanoic acid is sourced from PubChem (CID 161130297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).