C8H13KO4 — CID 87530861
potassium;ethane-1,2-diol;(2E,4E)-hexa-2,4-dienoate (PubChem CID 87530861) has the molecular formula C8H13KO4 and a molecular weight of 212.29 g/mol. Its IUPAC name is potassium;ethane-1,2-diol;(2E,4E)-hexa-2,4-dienoate.
| Compound Name | potassium;ethane-1,2-diol;(2E,4E)-hexa-2,4-dienoate |
|---|---|
| PubChem CID | 87530861 |
| Molecular Formula | C8H13KO4 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | potassium;ethane-1,2-diol;(2E,4E)-hexa-2,4-dienoate |
| SMILES | C/C=C/C=C/C(=O)[O-].OCCO.[K+] |
| InChI | InChI=1S/C6H8O2.C2H6O2.K/c1-2-3-4-5-6(7)8;3-1-2-4;/h2-5H,1H3,(H,7,8);3-4H,1-2H2;/q;;+1/p-1/b3-2+,5-4+;; |
| InChIKey | NZQVACOCHQBWND-IOUXFWSCSA-M |
| XLogP | -4.16 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | -4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|