C10H13KO7 — CID 175318409
potassium;(2E,4E)-hexa-2,4-dienoate;2-hydroxybutanedioic acid (PubChem CID 175318409) has the molecular formula C10H13KO7 and a molecular weight of 284.31 g/mol. Its IUPAC name is potassium;(2E,4E)-hexa-2,4-dienoate;2-hydroxybutanedioic acid.
| Compound Name | potassium;(2E,4E)-hexa-2,4-dienoate;2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 175318409 |
| Molecular Formula | C10H13KO7 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | potassium;(2E,4E)-hexa-2,4-dienoate;2-hydroxybutanedioic acid |
| SMILES | C/C=C/C=C/C(=O)[O-].O=C(O)CC(O)C(=O)O.[K+] |
| InChI | InChI=1S/C6H8O2.C4H6O5.K/c1-2-3-4-5-6(7)8;5-2(4(8)9)1-3(6)7;/h2-5H,1H3,(H,7,8);2,5H,1H2,(H,6,7)(H,8,9);/q;;+1/p-1/b3-2+,5-4+;; |
| InChIKey | MMVVGXBJGQJPAC-IOUXFWSCSA-M |
| XLogP | -4.22 |
| TPSA | 134.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|