C8H8FNO2 — CID 134446336
(1Z,3Z)-1-fluoro-5-methylidene-2-nitrohepta-1,3,6-triene (PubChem CID 134446336) has the molecular formula C8H8FNO2 and a molecular weight of 169.15 g/mol. Its IUPAC name is (1Z,3Z)-1-fluoro-5-methylidene-2-nitrohepta-1,3,6-triene.
| Compound Name | (1Z,3Z)-1-fluoro-5-methylidene-2-nitrohepta-1,3,6-triene |
|---|---|
| PubChem CID | 134446336 |
| Molecular Formula | C8H8FNO2 |
| Molecular Weight | 169.15 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | (1Z,3Z)-1-fluoro-5-methylidene-2-nitrohepta-1,3,6-triene |
| SMILES | C=CC(=C)/C=C\C(=C\F)[N+](=O)[O-] |
| InChI | InChI=1S/C8H8FNO2/c1-3-7(2)4-5-8(6-9)10(11)12/h3-6H,1-2H2/b5-4-,8-6- |
| InChIKey | OSWYPWYEEHIBHO-NADLECRISA-N |
| XLogP | 2.37 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.15 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|