C6H7I — CID 88942119
(1E)-1-iodo-3-methylidenepenta-1,4-diene (PubChem CID 88942119) has the molecular formula C6H7I and a molecular weight of 206.03 g/mol. Its IUPAC name is (1E)-1-iodo-3-methylidenepenta-1,4-diene.
| Compound Name | (1E)-1-iodo-3-methylidenepenta-1,4-diene |
|---|---|
| PubChem CID | 88942119 |
| Molecular Formula | C6H7I |
| Molecular Weight | 206.03 g/mol |
| Exact Mass | 205.96 |
| IUPAC Name | (1E)-1-iodo-3-methylidenepenta-1,4-diene |
| SMILES | C=CC(=C)/C=C/I |
| InChI | InChI=1S/C6H7I/c1-3-6(2)4-5-7/h3-5H,1-2H2/b5-4+ |
| InChIKey | VOKBJKZAZKNMFY-SNAWJCMRSA-N |
| XLogP | 2.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.03 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|