C10H14 — CID 173305203
buta-1,3-diene;3-methylidenepenta-1,4-diene (PubChem CID 173305203) has the molecular formula C10H14 and a molecular weight of 134.22 g/mol. Its IUPAC name is buta-1,3-diene;3-methylidenepenta-1,4-diene.
| Compound Name | buta-1,3-diene;3-methylidenepenta-1,4-diene |
|---|---|
| PubChem CID | 173305203 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | buta-1,3-diene;3-methylidenepenta-1,4-diene |
| SMILES | C=CC(=C)C=C.C=CC=C |
| InChI | InChI=1S/C6H8.C4H6/c1-4-6(3)5-2;1-3-4-2/h4-5H,1-3H2;3-4H,1-2H2 |
| InChIKey | XMTZJQJWOIOZQJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|