C15H20 — CID 91108049
(4E,6E,8E)-2,6-dimethyl-10-methylidenedodeca-1,4,6,8,11-pentaene (PubChem CID 91108049) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is (4E,6E,8E)-2,6-dimethyl-10-methylidenedodeca-1,4,6,8,11-pentaene.
| Compound Name | (4E,6E,8E)-2,6-dimethyl-10-methylidenedodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 91108049 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | (4E,6E,8E)-2,6-dimethyl-10-methylidenedodeca-1,4,6,8,11-pentaene |
| SMILES | C=CC(=C)/C=C/C=C(C)/C=C/CC(=C)C |
| InChI | InChI=1S/C15H20/c1-6-14(4)10-8-12-15(5)11-7-9-13(2)3/h6-8,10-12H,1-2,4,9H2,3,5H3/b10-8+,11-7+,15-12+ |
| InChIKey | XLAYOGJBFHOOIW-UIXYEUJBSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|