C7H12 — CID 5367524
(4E)-2-methylhexa-1,4-diene (PubChem CID 5367524) has the molecular formula C7H12 and a molecular weight of 96.17 g/mol. Its IUPAC name is (4E)-2-methylhexa-1,4-diene.
| Compound Name | (4E)-2-methylhexa-1,4-diene |
|---|---|
| PubChem CID | 5367524 |
| Molecular Formula | C7H12 |
| Molecular Weight | 96.17 g/mol |
| Exact Mass | 96.09 |
| IUPAC Name | (4E)-2-methylhexa-1,4-diene |
| SMILES | C=C(C)C/C=C/C |
| InChI | InChI=1S/C7H12/c1-4-5-6-7(2)3/h4-5H,2,6H2,1,3H3/b5-4+ |
| InChIKey | XBUBWPOBEDQVOO-SNAWJCMRSA-N |
| XLogP | 2.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 96.17 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|