C9H12F2 — CID 143057094
(3E,6Z)-2,4-difluoro-3-methylocta-1,3,6-triene (PubChem CID 143057094) has the molecular formula C9H12F2 and a molecular weight of 158.19 g/mol. Its IUPAC name is (3E,6Z)-2,4-difluoro-3-methylocta-1,3,6-triene.
| Compound Name | (3E,6Z)-2,4-difluoro-3-methylocta-1,3,6-triene |
|---|---|
| PubChem CID | 143057094 |
| Molecular Formula | C9H12F2 |
| Molecular Weight | 158.19 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (3E,6Z)-2,4-difluoro-3-methylocta-1,3,6-triene |
| SMILES | C=C(F)/C(C)=C(/F)C/C=C\C |
| InChI | InChI=1S/C9H12F2/c1-4-5-6-9(11)7(2)8(3)10/h4-5H,3,6H2,1-2H3/b5-4-,9-7+ |
| InChIKey | QDLDETHALQXKKC-XEQCUQEESA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.19 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|