About (7Z)-N,2-dimethyl-5-methylidenenona-2,7-dien-4-imine
(7Z)-N,2-dimethyl-5-methylidenenona-2,7-dien-4-imine (PubChem CID 143316591) has the molecular formula C12H19N
and a molecular weight of 177.29 g/mol. Its IUPAC name is (7Z)-N,2-dimethyl-5-methylidenenona-2,7-dien-4-imine.
Molecular Properties
| Compound Name | (7Z)-N,2-dimethyl-5-methylidenenona-2,7-dien-4-imine |
| PubChem CID | 143316591 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (7Z)-N,2-dimethyl-5-methylidenenona-2,7-dien-4-imine |
| SMILES | C=C(C/C=C\C)/C(C=C(C)C)=N/C |
| InChI | InChI=1S/C12H19N/c1-6-7-8-11(4)12(13-5)9-10(2)3/h6-7,9H,4,8H2,1-3,5H3/b7-6-,13-12+ |
| InChIKey | BZMBAWVEEJIXAQ-NQFDUOLLSA-N |
| XLogP | 3.55 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7Z)-N,2-dimethyl-5-methylidenenona-2,7-dien-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7Z)-N,2-dimethyl-5-methylidenenona-2,7-dien-4-imine?
The IUPAC name of (7Z)-N,2-dimethyl-5-methylidenenona-2,7-dien-4-imine (CID 143316591) is (7Z)-N,2-dimethyl-5-methylidenenona-2,7-dien-4-imine.
What is the SMILES notation for (7Z)-N,2-dimethyl-5-methylidenenona-2,7-dien-4-imine?
The canonical SMILES for (7Z)-N,2-dimethyl-5-methylidenenona-2,7-dien-4-imine is C=C(C/C=C\C)/C(C=C(C)C)=N/C.
What is the InChIKey of (7Z)-N,2-dimethyl-5-methylidenenona-2,7-dien-4-imine?
The InChIKey is BZMBAWVEEJIXAQ-NQFDUOLLSA-N. The full InChI is InChI=1S/C12H19N/c1-6-7-8-11(4)12(13-5)9-10(2)3/h6-7,9H,4,8H2,1-3,5H3/b7-6-,13-12+.
What are the key properties of (7Z)-N,2-dimethyl-5-methylidenenona-2,7-dien-4-imine?
(7Z)-N,2-dimethyl-5-methylidenenona-2,7-dien-4-imine has a molecular weight of 177.29 g/mol, XLogP of 3.55, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7Z)-N,2-dimethyl-5-methylidenenona-2,7-dien-4-imine is sourced from PubChem (CID 143316591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).