C11H18 — CID 150645087
6-methyldeca-1,5,8-triene (PubChem CID 150645087) has the molecular formula C11H18 and a molecular weight of 150.26 g/mol. Its IUPAC name is 6-methyldeca-1,5,8-triene.
| Compound Name | 6-methyldeca-1,5,8-triene |
|---|---|
| PubChem CID | 150645087 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 6-methyldeca-1,5,8-triene |
| SMILES | C=CCCC=C(C)CC=CC |
| InChI | InChI=1S/C11H18/c1-4-6-8-10-11(3)9-7-5-2/h4-5,7,10H,1,6,8-9H2,2-3H3 |
| InChIKey | JASCEOBJQNQQQV-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|