C17H28O — CID 101160594
(2E,4E,6R,10E)-6,10-dimethylpentadeca-2,4,10,14-tetraen-6-ol (PubChem CID 101160594) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is (2E,4E,6R,10E)-6,10-dimethylpentadeca-2,4,10,14-tetraen-6-ol.
| Compound Name | (2E,4E,6R,10E)-6,10-dimethylpentadeca-2,4,10,14-tetraen-6-ol |
|---|---|
| PubChem CID | 101160594 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | (2E,4E,6R,10E)-6,10-dimethylpentadeca-2,4,10,14-tetraen-6-ol |
| SMILES | C=CCC/C=C(\C)CCC[C@@](C)(O)/C=C/C=C/C |
| InChI | InChI=1S/C17H28O/c1-5-7-9-12-16(3)13-11-15-17(4,18)14-10-8-6-2/h5-6,8,10,12,14,18H,1,7,9,11,13,15H2,2-4H3/b8-6+,14-10+,16-12+/t17-/m0/s1 |
| InChIKey | IJMKBTIFAFPFSD-FLIANPARSA-N |
| XLogP | 4.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|