About 2-methylbut-2-ene;N-methylpropan-2-imine
2-methylbut-2-ene;N-methylpropan-2-imine (PubChem CID 161325778) has the molecular formula C9H19N
and a molecular weight of 141.26 g/mol. Its IUPAC name is 2-methylbut-2-ene;N-methylpropan-2-imine.
Molecular Properties
| Compound Name | 2-methylbut-2-ene;N-methylpropan-2-imine |
| PubChem CID | 161325778 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | 2-methylbut-2-ene;N-methylpropan-2-imine |
| SMILES | CC=C(C)C.CN=C(C)C |
| InChI | InChI=1S/C5H10.C4H9N/c1-4-5(2)3;1-4(2)5-3/h4H,1-3H3;1-3H3 |
| InChIKey | VKTCRQPODCJMJD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbut-2-ene;N-methylpropan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbut-2-ene;N-methylpropan-2-imine?
The IUPAC name of 2-methylbut-2-ene;N-methylpropan-2-imine (CID 161325778) is 2-methylbut-2-ene;N-methylpropan-2-imine.
What is the SMILES notation for 2-methylbut-2-ene;N-methylpropan-2-imine?
The canonical SMILES for 2-methylbut-2-ene;N-methylpropan-2-imine is CC=C(C)C.CN=C(C)C.
What is the InChIKey of 2-methylbut-2-ene;N-methylpropan-2-imine?
The InChIKey is VKTCRQPODCJMJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10.C4H9N/c1-4-5(2)3;1-4(2)5-3/h4H,1-3H3;1-3H3.
What are the key properties of 2-methylbut-2-ene;N-methylpropan-2-imine?
2-methylbut-2-ene;N-methylpropan-2-imine has a molecular weight of 141.26 g/mol, XLogP of 3.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbut-2-ene;N-methylpropan-2-imine is sourced from PubChem (CID 161325778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).