About cerium;2-methylprop-1-en-1-ol
cerium;2-methylprop-1-en-1-ol (PubChem CID 175572583) has the molecular formula C4H8CeO
and a molecular weight of 212.22 g/mol. Its IUPAC name is cerium;2-methylprop-1-en-1-ol.
Molecular Properties
| Compound Name | cerium;2-methylprop-1-en-1-ol |
| PubChem CID | 175572583 |
| Molecular Formula | C4H8CeO |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 211.96 |
| IUPAC Name | cerium;2-methylprop-1-en-1-ol |
| SMILES | CC(C)=CO.[Ce] |
| InChI | InChI=1S/C4H8O.Ce/c1-4(2)3-5;/h3,5H,1-2H3; |
| InChIKey | AEEYZQDIAAVGBC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze cerium;2-methylprop-1-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cerium;2-methylprop-1-en-1-ol?
The IUPAC name of cerium;2-methylprop-1-en-1-ol (CID 175572583) is cerium;2-methylprop-1-en-1-ol.
What is the SMILES notation for cerium;2-methylprop-1-en-1-ol?
The canonical SMILES for cerium;2-methylprop-1-en-1-ol is CC(C)=CO.[Ce].
What is the InChIKey of cerium;2-methylprop-1-en-1-ol?
The InChIKey is AEEYZQDIAAVGBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.Ce/c1-4(2)3-5;/h3,5H,1-2H3;.
What are the key properties of cerium;2-methylprop-1-en-1-ol?
cerium;2-methylprop-1-en-1-ol has a molecular weight of 212.22 g/mol, XLogP of 1.47, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cerium;2-methylprop-1-en-1-ol is sourced from PubChem (CID 175572583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).