C3H8O3 — CID 175907198
prop-1-ene-1,2-diol;hydrate (PubChem CID 175907198) has the molecular formula C3H8O3 and a molecular weight of 92.09 g/mol. Its IUPAC name is prop-1-ene-1,2-diol;hydrate.
| Compound Name | prop-1-ene-1,2-diol;hydrate |
|---|---|
| PubChem CID | 175907198 |
| Molecular Formula | C3H8O3 |
| Molecular Weight | 92.09 g/mol |
| Exact Mass | 92.05 |
| IUPAC Name | prop-1-ene-1,2-diol;hydrate |
| SMILES | CC(O)=CO.O |
| InChI | InChI=1S/C3H6O2.H2O/c1-3(5)2-4;/h2,4-5H,1H3;1H2 |
| InChIKey | ZCJLZOKIZRJDQR-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 92.09 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|