About copper;(Z)-4-hydroxypent-3-en-2-one;hydrate
copper;(Z)-4-hydroxypent-3-en-2-one;hydrate (PubChem CID 87530564) has the molecular formula C5H10CuO3
and a molecular weight of 181.68 g/mol. Its IUPAC name is copper;(Z)-4-hydroxypent-3-en-2-one;hydrate.
Molecular Properties
| Compound Name | copper;(Z)-4-hydroxypent-3-en-2-one;hydrate |
| PubChem CID | 87530564 |
| Molecular Formula | C5H10CuO3 |
| Molecular Weight | 181.68 g/mol |
| Exact Mass | 180.99 |
| IUPAC Name | copper;(Z)-4-hydroxypent-3-en-2-one;hydrate |
| SMILES | CC(=O)/C=C(/C)O.O.[Cu] |
| InChI | InChI=1S/C5H8O2.Cu.H2O/c1-4(6)3-5(2)7;;/h3,6H,1-2H3;;1H2/b4-3-;; |
| InChIKey | RWGZCLZMCJDHOM-GSBNXNDCSA-N |
| XLogP | 0.21 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.68 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze copper;(Z)-4-hydroxypent-3-en-2-one;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;(Z)-4-hydroxypent-3-en-2-one;hydrate?
The IUPAC name of copper;(Z)-4-hydroxypent-3-en-2-one;hydrate (CID 87530564) is copper;(Z)-4-hydroxypent-3-en-2-one;hydrate.
What is the SMILES notation for copper;(Z)-4-hydroxypent-3-en-2-one;hydrate?
The canonical SMILES for copper;(Z)-4-hydroxypent-3-en-2-one;hydrate is CC(=O)/C=C(/C)O.O.[Cu].
What is the InChIKey of copper;(Z)-4-hydroxypent-3-en-2-one;hydrate?
The InChIKey is RWGZCLZMCJDHOM-GSBNXNDCSA-N. The full InChI is InChI=1S/C5H8O2.Cu.H2O/c1-4(6)3-5(2)7;;/h3,6H,1-2H3;;1H2/b4-3-;;.
What are the key properties of copper;(Z)-4-hydroxypent-3-en-2-one;hydrate?
copper;(Z)-4-hydroxypent-3-en-2-one;hydrate has a molecular weight of 181.68 g/mol, XLogP of 0.21, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;(Z)-4-hydroxypent-3-en-2-one;hydrate is sourced from PubChem (CID 87530564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).