About 4-hydroxypent-3-en-2-one;titanium
4-hydroxypent-3-en-2-one;titanium (PubChem CID 162678859) has the molecular formula C5H8O2Ti
and a molecular weight of 147.98 g/mol. Its IUPAC name is 4-hydroxypent-3-en-2-one;titanium.
Molecular Properties
| Compound Name | 4-hydroxypent-3-en-2-one;titanium |
| PubChem CID | 162678859 |
| Molecular Formula | C5H8O2Ti |
| Molecular Weight | 147.98 g/mol |
| Exact Mass | 148.00 |
| IUPAC Name | 4-hydroxypent-3-en-2-one;titanium |
| SMILES | CC(=O)C=C(C)O.[Ti] |
| InChI | InChI=1S/C5H8O2.Ti/c1-4(6)3-5(2)7;/h3,6H,1-2H3; |
| InChIKey | FCIYXEHVZYFBSN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.98 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxypent-3-en-2-one;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxypent-3-en-2-one;titanium?
The IUPAC name of 4-hydroxypent-3-en-2-one;titanium (CID 162678859) is 4-hydroxypent-3-en-2-one;titanium.
What is the SMILES notation for 4-hydroxypent-3-en-2-one;titanium?
The canonical SMILES for 4-hydroxypent-3-en-2-one;titanium is CC(=O)C=C(C)O.[Ti].
What is the InChIKey of 4-hydroxypent-3-en-2-one;titanium?
The InChIKey is FCIYXEHVZYFBSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.Ti/c1-4(6)3-5(2)7;/h3,6H,1-2H3;.
What are the key properties of 4-hydroxypent-3-en-2-one;titanium?
4-hydroxypent-3-en-2-one;titanium has a molecular weight of 147.98 g/mol, XLogP of 1.03, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxypent-3-en-2-one;titanium is sourced from PubChem (CID 162678859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).