About bis((Z)-4-hydroxypent-3-en-2-one);rhodium
bis((Z)-4-hydroxypent-3-en-2-one);rhodium (PubChem CID 11358512) has the molecular formula C10H16O4Rh
and a molecular weight of 303.14 g/mol. Its IUPAC name is bis((Z)-4-hydroxypent-3-en-2-one);rhodium.
Molecular Properties
| Compound Name | bis((Z)-4-hydroxypent-3-en-2-one);rhodium |
| PubChem CID | 11358512 |
| Molecular Formula | C10H16O4Rh |
| Molecular Weight | 303.14 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | bis((Z)-4-hydroxypent-3-en-2-one);rhodium |
| SMILES | CC(=O)/C=C(/C)O.CC(=O)/C=C(/C)O.[Rh] |
| InChI | InChI=1S/2C5H8O2.Rh/c2*1-4(6)3-5(2)7;/h2*3,6H,1-2H3;/b2*4-3-; |
| InChIKey | PHZMDSZZCMBTGP-FDGPNNRMSA-N |
| XLogP | 2.07 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.14 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((Z)-4-hydroxypent-3-en-2-one);rhodium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((Z)-4-hydroxypent-3-en-2-one);rhodium?
The IUPAC name of bis((Z)-4-hydroxypent-3-en-2-one);rhodium (CID 11358512) is bis((Z)-4-hydroxypent-3-en-2-one);rhodium.
What is the SMILES notation for bis((Z)-4-hydroxypent-3-en-2-one);rhodium?
The canonical SMILES for bis((Z)-4-hydroxypent-3-en-2-one);rhodium is CC(=O)/C=C(/C)O.CC(=O)/C=C(/C)O.[Rh].
What is the InChIKey of bis((Z)-4-hydroxypent-3-en-2-one);rhodium?
The InChIKey is PHZMDSZZCMBTGP-FDGPNNRMSA-N. The full InChI is InChI=1S/2C5H8O2.Rh/c2*1-4(6)3-5(2)7;/h2*3,6H,1-2H3;/b2*4-3-;.
What are the key properties of bis((Z)-4-hydroxypent-3-en-2-one);rhodium?
bis((Z)-4-hydroxypent-3-en-2-one);rhodium has a molecular weight of 303.14 g/mol, XLogP of 2.07, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis((Z)-4-hydroxypent-3-en-2-one);rhodium is sourced from PubChem (CID 11358512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).