C4H7Br — CID 76973307
1-bromo-2-(113C)methyl(1,3-13C2)prop-1-ene (PubChem CID 76973307) has the molecular formula C4H7Br and a molecular weight of 137.98 g/mol. Its IUPAC name is 1-bromo-2-(113C)methyl(1,3-13C2)prop-1-ene.
| Compound Name | 1-bromo-2-(113C)methyl(1,3-13C2)prop-1-ene |
|---|---|
| PubChem CID | 76973307 |
| Molecular Formula | C4H7Br |
| Molecular Weight | 137.98 g/mol |
| Exact Mass | 136.98 |
| IUPAC Name | 1-bromo-2-(113C)methyl(1,3-13C2)prop-1-ene |
| SMILES | [13CH3]C([13CH3])=[13CH]Br |
| InChI | InChI=1S/C4H7Br/c1-4(2)3-5/h3H,1-2H3/i1+1,2+1,3+1 |
| InChIKey | DEFNUDNHTUZJAL-VMIGTVKRSA-N |
| XLogP | 2.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.98 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |