C12H17Br — CID 58730070
(1E,3E,5E)-1-bromo-2,3,6,7-tetramethylocta-1,3,5,7-tetraene (PubChem CID 58730070) has the molecular formula C12H17Br and a molecular weight of 241.17 g/mol. Its IUPAC name is (1E,3E,5E)-1-bromo-2,3,6,7-tetramethylocta-1,3,5,7-tetraene.
| Compound Name | (1E,3E,5E)-1-bromo-2,3,6,7-tetramethylocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 58730070 |
| Molecular Formula | C12H17Br |
| Molecular Weight | 241.17 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | (1E,3E,5E)-1-bromo-2,3,6,7-tetramethylocta-1,3,5,7-tetraene |
| SMILES | C=C(C)/C(C)=C/C=C(C)/C(C)=C/Br |
| InChI | InChI=1S/C12H17Br/c1-9(2)10(3)6-7-11(4)12(5)8-13/h6-8H,1H2,2-5H3/b10-6+,11-7+,12-8+ |
| InChIKey | FGQVYFWJDZDDSX-LRVPIKKLSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.17 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|