C12H19N — CID 143363501
(3E,5E)-N,3,6,7-tetramethylocta-1,3,5,7-tetraen-2-amine (PubChem CID 143363501) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (3E,5E)-N,3,6,7-tetramethylocta-1,3,5,7-tetraen-2-amine.
| Compound Name | (3E,5E)-N,3,6,7-tetramethylocta-1,3,5,7-tetraen-2-amine |
|---|---|
| PubChem CID | 143363501 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (3E,5E)-N,3,6,7-tetramethylocta-1,3,5,7-tetraen-2-amine |
| SMILES | C=C(C)/C(C)=C/C=C(\C)C(=C)NC |
| InChI | InChI=1S/C12H19N/c1-9(2)10(3)7-8-11(4)12(5)13-6/h7-8,13H,1,5H2,2-4,6H3/b10-7+,11-8+ |
| InChIKey | VAFFKAQWLDAFHG-AMMQDNIMSA-N |
| XLogP | 3.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|