C10H17N3 — CID 170238138
(3E)-5-(2-ethenylhydrazinyl)-N,3-dimethylhexa-1,3,5-trien-2-amine (PubChem CID 170238138) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is (3E)-5-(2-ethenylhydrazinyl)-N,3-dimethylhexa-1,3,5-trien-2-amine.
| Compound Name | (3E)-5-(2-ethenylhydrazinyl)-N,3-dimethylhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 170238138 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | (3E)-5-(2-ethenylhydrazinyl)-N,3-dimethylhexa-1,3,5-trien-2-amine |
| SMILES | C=CNNC(=C)/C=C(\C)C(=C)NC |
| InChI | InChI=1S/C10H17N3/c1-6-12-13-9(3)7-8(2)10(4)11-5/h6-7,11-13H,1,3-4H2,2,5H3/b8-7+ |
| InChIKey | NGJKLOPONRMKEA-BQYQJAHWSA-N |
| XLogP | 1.42 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|