C10H15N — CID 143240550
(3E)-N,2-dimethyl-5-methylidenehepta-1,3,6-trien-4-amine (PubChem CID 143240550) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is (3E)-N,2-dimethyl-5-methylidenehepta-1,3,6-trien-4-amine.
| Compound Name | (3E)-N,2-dimethyl-5-methylidenehepta-1,3,6-trien-4-amine |
|---|---|
| PubChem CID | 143240550 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (3E)-N,2-dimethyl-5-methylidenehepta-1,3,6-trien-4-amine |
| SMILES | C=CC(=C)/C(=C\C(=C)C)NC |
| InChI | InChI=1S/C10H15N/c1-6-9(4)10(11-5)7-8(2)3/h6-7,11H,1-2,4H2,3,5H3/b10-7+ |
| InChIKey | AEPUBZLRWKNRRI-JXMROGBWSA-N |
| XLogP | 2.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|