C10H14 — CID 144801201
(5E)-5-methyl-3,4-dimethylidenehepta-1,5-diene (PubChem CID 144801201) has the molecular formula C10H14 and a molecular weight of 134.22 g/mol. Its IUPAC name is (5E)-5-methyl-3,4-dimethylidenehepta-1,5-diene.
| Compound Name | (5E)-5-methyl-3,4-dimethylidenehepta-1,5-diene |
|---|---|
| PubChem CID | 144801201 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | (5E)-5-methyl-3,4-dimethylidenehepta-1,5-diene |
| SMILES | C=CC(=C)C(=C)/C(C)=C/C |
| InChI | InChI=1S/C10H14/c1-6-8(3)10(5)9(4)7-2/h6-7H,1,3,5H2,2,4H3/b9-7+ |
| InChIKey | PASWUTMKLCLNCS-VQHVLOKHSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|