C11H16 — CID 91458758
5-ethyl-3,4-dimethylidenehepta-1,5-diene (PubChem CID 91458758) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is 5-ethyl-3,4-dimethylidenehepta-1,5-diene.
| Compound Name | 5-ethyl-3,4-dimethylidenehepta-1,5-diene |
|---|---|
| PubChem CID | 91458758 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 5-ethyl-3,4-dimethylidenehepta-1,5-diene |
| SMILES | C=CC(=C)C(=C)C(=CC)CC |
| InChI | InChI=1S/C11H16/c1-6-9(4)10(5)11(7-2)8-3/h6-7H,1,4-5,8H2,2-3H3 |
| InChIKey | FLECZRAMLAGKEZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|