C21H38 — CID 167492357
ethane;(4E,7Z)-7-ethyl-2,3-dimethyl-6-methylidene-5-prop-1-en-2-ylnona-2,4,7-triene (PubChem CID 167492357) has the molecular formula C21H38 and a molecular weight of 290.54 g/mol. Its IUPAC name is ethane;(4E,7Z)-7-ethyl-2,3-dimethyl-6-methylidene-5-prop-1-en-2-ylnona-2,4,7-triene.
| Compound Name | ethane;(4E,7Z)-7-ethyl-2,3-dimethyl-6-methylidene-5-prop-1-en-2-ylnona-2,4,7-triene |
|---|---|
| PubChem CID | 167492357 |
| Molecular Formula | C21H38 |
| Molecular Weight | 290.54 g/mol |
| Exact Mass | 290.30 |
| IUPAC Name | ethane;(4E,7Z)-7-ethyl-2,3-dimethyl-6-methylidene-5-prop-1-en-2-ylnona-2,4,7-triene |
| SMILES | C=C(C)/C(=C\C(C)=C(C)C)C(=C)/C(=C\C)CC.CC.CC |
| InChI | InChI=1S/C17H26.2C2H6/c1-9-16(10-2)15(8)17(13(5)6)11-14(7)12(3)4;2*1-2/h9,11H,5,8,10H2,1-4,6-7H3;2*1-2H3/b16-9-,17-11+;; |
| InChIKey | LCKZADAHHQSJHZ-JVKQEIMHSA-N |
| XLogP | 7.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.54 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|