C19H28 — CID 144612607
prop-1-ene;(4Z,8Z)-3,6,7,10-tetramethylidenedodeca-4,8-diene (PubChem CID 144612607) has the molecular formula C19H28 and a molecular weight of 256.43 g/mol. Its IUPAC name is prop-1-ene;(4Z,8Z)-3,6,7,10-tetramethylidenedodeca-4,8-diene.
| Compound Name | prop-1-ene;(4Z,8Z)-3,6,7,10-tetramethylidenedodeca-4,8-diene |
|---|---|
| PubChem CID | 144612607 |
| Molecular Formula | C19H28 |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | prop-1-ene;(4Z,8Z)-3,6,7,10-tetramethylidenedodeca-4,8-diene |
| SMILES | C=C(/C=C\C(=C)C(=C)/C=C/C(=C)CC)CC.C=CC |
| InChI | InChI=1S/C16H22.C3H6/c1-7-13(3)9-11-15(5)16(6)12-10-14(4)8-2;1-3-2/h9-12H,3-8H2,1-2H3;3H,1H2,2H3/b11-9-,12-10-; |
| InChIKey | WORWQAJJWLUSBZ-GGDOQLOUSA-N |
| XLogP | 6.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|