C24H33F — CID 144909675
ethene;(3Z)-6-(fluoromethyl)-2-methyl-5-methylidenehepta-1,3,6-triene;(5Z)-3,4,7-trimethylidenenona-1,5-diene (PubChem CID 144909675) has the molecular formula C24H33F and a molecular weight of 340.53 g/mol. Its IUPAC name is ethene;(3Z)-6-(fluoromethyl)-2-methyl-5-methylidenehepta-1,3,6-triene;(5Z)-3,4,7-trimethylidenenona-1,5-diene.
| Compound Name | ethene;(3Z)-6-(fluoromethyl)-2-methyl-5-methylidenehepta-1,3,6-triene;(5Z)-3,4,7-trimethylidenenona-1,5-diene |
|---|---|
| PubChem CID | 144909675 |
| Molecular Formula | C24H33F |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | ethene;(3Z)-6-(fluoromethyl)-2-methyl-5-methylidenehepta-1,3,6-triene;(5Z)-3,4,7-trimethylidenenona-1,5-diene |
| SMILES | C=C.C=C(C)/C=C\C(=C)C(=C)CF.C=CC(=C)C(=C)/C=C\C(=C)CC |
| InChI | InChI=1S/C12H16.C10H13F.C2H4/c1-6-10(3)8-9-12(5)11(4)7-2;1-8(2)5-6-9(3)10(4)7-11;1-2/h7-9H,2-6H2,1H3;5-6H,1,3-4,7H2,2H3;1-2H2/b9-8-;6-5-; |
| InChIKey | PPHBLYVWNMPLPV-UCOMPKPFSA-N |
| XLogP | 7.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|