C15H17F3 — CID 145480576
(3E,7Z)-5,6,9-trimethylidene-3-(trifluoromethyl)undeca-1,3,7-triene (PubChem CID 145480576) has the molecular formula C15H17F3 and a molecular weight of 254.29 g/mol. Its IUPAC name is (3E,7Z)-5,6,9-trimethylidene-3-(trifluoromethyl)undeca-1,3,7-triene.
| Compound Name | (3E,7Z)-5,6,9-trimethylidene-3-(trifluoromethyl)undeca-1,3,7-triene |
|---|---|
| PubChem CID | 145480576 |
| Molecular Formula | C15H17F3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (3E,7Z)-5,6,9-trimethylidene-3-(trifluoromethyl)undeca-1,3,7-triene |
| SMILES | C=C/C(=C\C(=C)C(=C)/C=C/C(=C)CC)C(F)(F)F |
| InChI | InChI=1S/C15H17F3/c1-6-11(3)8-9-12(4)13(5)10-14(7-2)15(16,17)18/h7-10H,2-6H2,1H3/b9-8-,14-10+ |
| InChIKey | WSCZODREWSFUNE-MYSCJDEHSA-N |
| XLogP | 5.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|