C8H10F3P — CID 142032731
[(3E)-2-methylidene-4-(trifluoromethyl)hexa-3,5-dienyl]phosphane (PubChem CID 142032731) has the molecular formula C8H10F3P and a molecular weight of 194.14 g/mol. Its IUPAC name is [(3E)-2-methylidene-4-(trifluoromethyl)hexa-3,5-dienyl]phosphane.
| Compound Name | [(3E)-2-methylidene-4-(trifluoromethyl)hexa-3,5-dienyl]phosphane |
|---|---|
| PubChem CID | 142032731 |
| Molecular Formula | C8H10F3P |
| Molecular Weight | 194.14 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | [(3E)-2-methylidene-4-(trifluoromethyl)hexa-3,5-dienyl]phosphane |
| SMILES | C=C/C(=C\C(=C)CP)C(F)(F)F |
| InChI | InChI=1S/C8H10F3P/c1-3-7(8(9,10)11)4-6(2)5-12/h3-4H,1-2,5,12H2/b7-4+ |
| InChIKey | IPTMWEUYLXEPCT-QPJJXVBHSA-N |
| XLogP | 3.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.14 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|