C14H21F3O — CID 143267835
(7Z,8E)-7-ethylidene-9-(trifluoromethyl)undeca-8,10-dien-5-ol (PubChem CID 143267835) has the molecular formula C14H21F3O and a molecular weight of 262.31 g/mol. Its IUPAC name is (7Z,8E)-7-ethylidene-9-(trifluoromethyl)undeca-8,10-dien-5-ol.
| Compound Name | (7Z,8E)-7-ethylidene-9-(trifluoromethyl)undeca-8,10-dien-5-ol |
|---|---|
| PubChem CID | 143267835 |
| Molecular Formula | C14H21F3O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | (7Z,8E)-7-ethylidene-9-(trifluoromethyl)undeca-8,10-dien-5-ol |
| SMILES | C=C/C(=C\C(=C/C)CC(O)CCCC)C(F)(F)F |
| InChI | InChI=1S/C14H21F3O/c1-4-7-8-13(18)10-11(5-2)9-12(6-3)14(15,16)17/h5-6,9,13,18H,3-4,7-8,10H2,1-2H3/b11-5+,12-9+ |
| InChIKey | UKVLPIKFFZYMRG-HQOQYNLBSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|