C12H17F3O — CID 143267432
(5Z,6E)-5-ethylidene-6-(trifluoromethyl)nona-6,8-dien-3-ol (PubChem CID 143267432) has the molecular formula C12H17F3O and a molecular weight of 234.26 g/mol. Its IUPAC name is (5Z,6E)-5-ethylidene-6-(trifluoromethyl)nona-6,8-dien-3-ol.
| Compound Name | (5Z,6E)-5-ethylidene-6-(trifluoromethyl)nona-6,8-dien-3-ol |
|---|---|
| PubChem CID | 143267432 |
| Molecular Formula | C12H17F3O |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | (5Z,6E)-5-ethylidene-6-(trifluoromethyl)nona-6,8-dien-3-ol |
| SMILES | C=C/C=C(C(=C/C)\CC(O)CC)/C(F)(F)F |
| InChI | InChI=1S/C12H17F3O/c1-4-7-11(12(13,14)15)9(5-2)8-10(16)6-3/h4-5,7,10,16H,1,6,8H2,2-3H3/b9-5-,11-7+ |
| InChIKey | FZNPHYOICGPABB-KGAZIEBHSA-N |
| XLogP | 3.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|