C11H13F3 — CID 144776103
(3E,5E)-3,4-dimethyl-5-(trifluoromethyl)octa-1,3,5,7-tetraene (PubChem CID 144776103) has the molecular formula C11H13F3 and a molecular weight of 202.22 g/mol. Its IUPAC name is (3E,5E)-3,4-dimethyl-5-(trifluoromethyl)octa-1,3,5,7-tetraene.
| Compound Name | (3E,5E)-3,4-dimethyl-5-(trifluoromethyl)octa-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 144776103 |
| Molecular Formula | C11H13F3 |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (3E,5E)-3,4-dimethyl-5-(trifluoromethyl)octa-1,3,5,7-tetraene |
| SMILES | C=C/C=C(C(\C)=C(/C)C=C)/C(F)(F)F |
| InChI | InChI=1S/C11H13F3/c1-5-7-10(11(12,13)14)9(4)8(3)6-2/h5-7H,1-2H2,3-4H3/b9-8+,10-7+ |
| InChIKey | DVQNCLDNPHYUFW-DGLUDJRXSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|